CymitQuimica logo

CAS 67383-32-8

:

5-Pyrimidinecarboxylic acid, 4-hydroxy-2-methyl-, ethyl ester

Description:
5-Pyrimidinecarboxylic acid, 4-hydroxy-2-methyl-, ethyl ester, with the CAS number 67383-32-8, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a carboxylic acid functional group and an ester group, indicating it can participate in various chemical reactions, such as esterification and hydrolysis. The presence of a hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its solubility in polar solvents. The methyl group at the 2-position of the pyrimidine ring influences its reactivity and steric properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 5-Pyrimidinecarboxylic acid, 4-hydroxy-2-methyl-, ethyl ester is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-3-13-8(12)6-4-9-5(2)10-7(6)11/h4H,3H2,1-2H3,(H,9,10,11)
InChI key:InChIKey=KTZQDIINDVWLES-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(O)=NC(C)=NC1
Synonyms:
  • 5-Pyrimidinecarboxylic acid, 4-hydroxy-2-methyl-, ethyl ester
Found 2 products.