CymitQuimica logo

CAS 67475-56-3

:

5-fluoro-2-methoxybenzenesulfonyl chloride

Description:
5-Fluoro-2-methoxybenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a fluorine atom and a methoxy group attached to a benzene ring, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions, which are valuable in the synthesis of various pharmaceuticals and agrochemicals. The fluorine atom can enhance the compound's lipophilicity and biological activity, while the methoxy group can influence its solubility and reactivity. Additionally, this compound is typically handled with care due to its potential to release toxic gases upon hydrolysis. Overall, 5-fluoro-2-methoxybenzenesulfonyl chloride is a versatile intermediate in synthetic chemistry, particularly in the development of sulfonamide derivatives and other functionalized aromatic compounds.
Formula:C7H6ClFO3S
InChI:InChI=1/C7H6ClFO3S/c1-12-6-3-2-5(9)4-7(6)13(8,10)11/h2-4H,1H3
InChI key:LUEBMKPHZDSPFH-UHFFFAOYSA-N
SMILES:COc1ccc(cc1S(=O)(=O)Cl)F
Synonyms:
  • Benzenesulfonyl chloride, 5-fluoro-2-methoxy-
Found 4 products.