CAS 67478-50-6
:1-Tritylimidazole-2-carboxaldehyde
Description:
1-Tritylimidazole-2-carboxaldehyde is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a trityl group, which is a bulky phenyl group that enhances its stability and solubility in organic solvents. The presence of a carboxaldehyde functional group contributes to its reactivity, making it useful in various organic synthesis applications, particularly in the formation of imidazole derivatives. The compound is typically a solid at room temperature and may exhibit moderate to high melting points, depending on its purity and crystalline form. Its chemical properties allow it to participate in nucleophilic addition reactions, and it can serve as a building block in the synthesis of more complex molecules. Additionally, 1-Tritylimidazole-2-carboxaldehyde may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C23H18N2O
InChI:InChI=1/C23H18N2O/c26-18-22-24-16-17-25(22)23(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1ccnc1C=O
Synonyms:- 1-trityl-1H-imidazole-2-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Trityl-1H-imidazole-2-carbaldehyde
CAS:Formula:C23H18N2OPurity:97%Color and Shape:SolidMolecular weight:338.40181-Trityl-1H-imidazole-2-carboxaldehyde
CAS:1-Trityl-1H-imidazole-2-carboxaldehydeFormula:C23H18N2OPurity:97%Color and Shape: off white solidMolecular weight:338.40g/mol1-Trityl-1H-imidazole-2-carboxaldehyde
CAS:1-Trityl-1H-imidazole-2-carboxaldehyde is a formylating agent that inhibits tumor growth and has anti-proliferative effects. It binds to the c–h bond of imidazoles in human prostate cells and forms a stable, cell cycle-specific metabolite. This metabolite has been shown to inhibit tumor growth in vivo. 1-Trityl-1H-imidazole-2-carboxaldehyde may be useful as a chemotherapeutic agent for prostate cancer or other cancers with similar metabolic profiles.Formula:C23H18N2OPurity:Min. 95%Molecular weight:338.41 g/mol




