CymitQuimica logo

CAS 67492-50-6

:

3,5-Dichlorophenyl Boronic Acid

Description:
3,5-Dichlorophenyl boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a dichlorophenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as methanol and ethanol, but less soluble in non-polar solvents. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The presence of chlorine substituents at the 3 and 5 positions on the phenyl ring can influence the compound's reactivity and biological activity, often enhancing its properties for specific applications. 3,5-Dichlorophenyl boronic acid is utilized in the development of pharmaceuticals, agrochemicals, and as a reagent in cross-coupling reactions, such as Suzuki coupling, which is pivotal in forming carbon-carbon bonds in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H5BCl2O2
InChI:InChI=1/C6H5BCl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H
InChI key:DKYRKAIKWFHQHM-UHFFFAOYSA-N
SMILES:c1c(cc(cc1Cl)Cl)B(O)O
Synonyms:
  • 3,5-Dichlorobenzeneboronic acid
  • 3,5-Dichlophenylboronic acid
  • 3,5-Dichlorophenylboronic acid
Found 8 products.