CymitQuimica logo

CAS 67625-38-1

:

Ethyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate

Description:
Ethyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a chloro substituent and an ethyl ester functional group. This compound typically exhibits a molecular formula that reflects its complex structure, featuring a fused imidazole and pyridine ring system. The presence of the chloro group introduces specific reactivity and influences the compound's physical properties, such as solubility and boiling point. Ethyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate is often studied for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. Its synthesis usually involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy. Safety data sheets should be consulted for handling and storage guidelines, as with many chemical substances, to ensure proper safety measures are taken due to potential hazards associated with its use.
Formula:C10H9ClN2O2
InChI:InChI=1S/C10H9ClN2O2/c1-2-15-10(14)8-6-13-5-7(11)3-4-9(13)12-8/h3-6H,2H2,1H3
InChI key:InChIKey=JWGKTXNASUZJAQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CN2C(=N1)C=CC(Cl)=C2
Synonyms:
  • 6-Chloroimidazo[1,2-A]Pyridine-2-Carboxylic Acid Ethyl Ester
  • Ethyl 6-Chloroimidazo[1,2-A]Pyridine-2-Carboxylate
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-chloro-, ethyl ester
Found 4 products.