CAS 67644-00-2
:L-Prolyl-L-glutamic acid
Description:
L-Prolyl-L-glutamic acid, with the CAS number 67644-00-2, is a dipeptide composed of the amino acids proline and glutamic acid. This compound is characterized by its unique structure, where proline, a cyclic amino acid, is linked to glutamic acid, which contains a carboxylic acid side chain. L-Prolyl-L-glutamic acid is known for its role in various biological processes, including protein synthesis and cellular signaling. It exhibits properties typical of peptides, such as solubility in water and the ability to form hydrogen bonds, which can influence its biological activity and interactions with other molecules. Additionally, this dipeptide may have implications in pharmaceutical research, particularly in the development of drugs targeting neurological and metabolic disorders. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and therapeutic contexts. Overall, L-Prolyl-L-glutamic acid is a significant compound in biochemistry with potential applications in health and medicine.
Formula:C10H16N2O5
InChI:InChI=1S/C10H16N2O5/c13-8(14)4-3-7(10(16)17)12-9(15)6-2-1-5-11-6/h6-7,11H,1-5H2,(H,12,15)(H,13,14)(H,16,17)/t6-,7-/m0/s1
InChI key:InChIKey=QLROSWPKSBORFJ-BQBZGAKWSA-N
SMILES:C(N[C@@H](CCC(O)=O)C(O)=O)(=O)[C@@H]1CCCN1
Synonyms:- 107: PN: US20130123467 SEQID: 130 claimed protein
- 459: PN: WO2005081628 SEQID: 1568 claimed protein
- <span class="text-smallcaps">L</smallcap>-Glutamic acid, <smallcap>L</span>-prolyl-
- <span class="text-smallcaps">L</smallcap>-Glutamic acid, N-<smallcap>L</span>-prolyl-
- <span class="text-smallcaps">L</smallcap>-Prolyl-<smallcap>L</span>-glutamic acid
- L-glutamic acid, L-prolyl-
- L-Glutamic acid, N-L-prolyl-
- 11: PN: WO2014063098 TABLE: 5 claimed protein
- L-Prolyl-L-glutamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
H-Pro-Glu-OH
CAS:Substrate for prolinase (prolyl dipeptidase).Formula:C10H16N2O5Purity:> 99%Color and Shape:White PowderMolecular weight:244.25(S)-2-((S)-Pyrrolidine-2-carboxamido)pentanedioic acid
CAS:(S)-2-((S)-Pyrrolidine-2-carboxamido)pentanedioic acidFormula:C10H16N2O5Purity:98%Molecular weight:244.25(2S)-2-{[(2S)-pyrrolidin-2-yl]formamido}pentanedioic acid
CAS:Formula:C10H16N2O5Purity:95%Color and Shape:SolidMolecular weight:244.2444Prolylglutamic acid
CAS:Prolylglutamic acid (H-Pro-Glu-OH) is a proline-glutamic acid dipeptide and endogenous metabolite, targeting the LipY lipase of pathogenic mycobacteria.Formula:C10H16N2O5Color and Shape:SolidMolecular weight:244.24H-Pro-Glu-Oh
CAS:Controlled ProductApplications H-PRO-GLU-OH (cas# 67644-00-2) is a useful research chemical.
Formula:C10H16N2O5Color and Shape:NeatMolecular weight:244.244H-Pro-Glu-OH
CAS:H-Pro-Glu-OH is a homologous peptide that belongs to the group of proteins. It is synthesized in the cells by polymerase chain reaction and can be used for diagnosis of infectious diseases. It has been shown to induce antibody response in mice. H-Pro-Glu-OH is also active against Mycobacterium tuberculosis, which may be due to its ability to bind to the tyrosine kinase domain on protein genes. This peptide has been shown to have anti-inflammatory properties, inhibiting fatty acid production and leading to necrotic cell death.Formula:C10H16N2O5Purity:Min. 95%Molecular weight:244.24 g/mol





