CymitQuimica logo

CAS 6769-80-8

:

5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt

Description:
5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt is a chemical compound commonly used in biochemical research, particularly in the study of enzyme activity and as a substrate for various assays. This compound features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring, and is substituted with bromine and chlorine atoms, enhancing its reactivity. The phosphate group in its structure makes it a phosphate ester, which is significant in biological systems as it can participate in phosphorylation reactions. The p-toluidine salt form indicates that it is paired with p-toluidine, a derivative of aniline, which can influence its solubility and stability in solution. This compound is often utilized in colorimetric assays, where it can produce a colored product upon enzymatic cleavage, allowing for the quantification of enzyme activity. Its unique structural features and reactivity make it a valuable tool in molecular biology and biochemistry.
Formula:C15H15BrClN2O4P
InChI:InChI=1S/C8H6BrClNO4P.C7H9N/c9-5-1-4-7(2-6(5)10)11-3-8(4)15-16(12,13)14;1-6-2-4-7(8)5-3-6/h1-3,11H,(H2,12,13,14);2-5H,8H2,1H3
InChI key:WUHVYTJTZAKPOS-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)N.C1=C2C(=CC(=C1Br)Cl)NC=C2OP(=O)(O)O
Found 8 products.