CymitQuimica logo

CAS 677338-12-4

:

3-Pyridinecarboxamide,N-(2,3-dihydro-7,8-dimethoxyimidazo[1,2-c]quinazolin-5-yl)-

Description:
3-Pyridinecarboxamide, N-(2,3-dihydro-7,8-dimethoxyimidazo[1,2-c]quinazolin-5-yl)- is a chemical compound characterized by its complex structure, which includes a pyridine ring and an imidazoquinazoline moiety. This compound is typically classified as a heterocyclic organic molecule, featuring nitrogen atoms in its ring systems, which contribute to its potential biological activity. The presence of methoxy groups suggests that it may exhibit specific electronic properties, influencing its reactivity and solubility. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The molecular structure may allow for interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's CAS number, 677338-12-4, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and biological contexts. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of organic chemistry.
Formula:C18H17N5O3
InChI:InChI=1S/C18H17N5O3/c1-25-13-6-5-12-14(15(13)26-2)21-18(23-9-8-20-16(12)23)22-17(24)11-4-3-7-19-10-11/h3-7,10,20H,8-9H2,1-2H3
InChI key:FCKJZIRDZMVDEM-UHFFFAOYSA-N
SMILES:COC1=C(C2=NC(=NC(=O)C3=CN=CC=C3)N4CCNC4=C2C=C1)OC
Synonyms:
  • Pik 85
  • Pik90
  • N-(2,3-Dihydro-7,8-dimethoxyimidazo[1,2-c]quinazolin-5-yl)-3-pyridinecarboxamide
Found 7 products.