CymitQuimica logo

CAS 67899-00-7

:

2-Amino-4-methylthiazole-5-carboxylic acid

Description:
2-Amino-4-methylthiazole-5-carboxylic acid, with the CAS number 67899-00-7, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its polar nature and potential for hydrogen bonding. The presence of the methyl group at the 4-position of the thiazole ring influences its solubility and reactivity. It is typically a white to off-white crystalline solid, and its molecular structure allows it to participate in various chemical reactions, making it useful in synthetic organic chemistry and potentially in pharmaceutical applications. The compound's properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other substances. Overall, 2-Amino-4-methylthiazole-5-carboxylic acid is of interest in both research and industrial contexts due to its unique structural features and functional groups.
Formula:C5H6N2O2S
InChI:InChI=1/C5H6N2O2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H2,6,7)(H,8,9)
InChI key:QCVFVGONDMKXEE-UHFFFAOYSA-N
SMILES:Cc1c(C(=O)O)sc(=N)[nH]1
Synonyms:
  • 2-Amino-4-methyl-1,3-thiazole-5-carboxylic acid
Found 4 products.