CAS 67909-49-3
:14-methyl-5-oxo-5,7,8,8a,13a,14-hexahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-6-ium-13-ide
Description:
The chemical substance known as 14-methyl-5-oxo-5,7,8,8a,13a,14-hexahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-6-ium-13-ide, with the CAS number 67909-49-3, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indole and quinazoline moieties. This compound features a hexahydroindolo framework, indicating a saturated ring system, and includes a methyl group and a ketone functional group, which contribute to its chemical reactivity and potential biological activity. The presence of a quaternary ammonium ion suggests that it may exhibit ionic properties, influencing its solubility and interaction with biological systems. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. The intricate structure and functional groups present in this compound may also allow for various synthetic modifications, making it a candidate for further research in drug development and chemical synthesis.
Formula:C19H17N3O
InChI:InChI=1/C19H17N3O/c1-21-16-9-5-3-7-14(16)19(23)22-11-10-13-12-6-2-4-8-15(12)20-17(13)18(21)22/h2-9,13,17H,10-11H2,1H3
SMILES:C[n+]1c2ccccc2c(=O)n2CCC3c4ccccc4[N-]C3c12
Synonyms:- 14-Methyl-5-oxo-7,8,8a,13a-tetrahydro-5H-indolo[2',3':3,4]pyrido[2,1-b]quinazolin-14-ium-13-ide
- Indolo[2',3':3,4]Pyrido[2,1-B]Quinazolinium, 5,7,8,8A,13,13A-Hexahydro-14-Methyl-5-Oxo-, Inner Salt
- Dehydroevodiamine
- Dehydroevodiamine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dehydroevodiamine
CAS:Dehydroevodiamine (DHED), a constituent of Evodia rutaecarpa, has various biological effects such as hypotensive, negative chronotropic, ion channel depressantFormula:C19H15N3OPurity:99.54%Color and Shape:SolidMolecular weight:301.3414-Methyl-5-oxo-7,8-dihydro-5H-indolo[2′,3′:3,4]pyrido[2,1-b]quinazolin-14-ium-13-ide
CAS:Formula:C19H15N3OPurity:98%Molecular weight:301.349Dehydroevodiamine
CAS:Dehydroevodiamine is a plant-derived indole alkaloid, which is extracted from the fruit of the Evodia rutaecarpa plant. This compound is garnering scientific interest due to its potential neuroprotective properties. The mode of action of dehydroevodiamine is multifaceted, involving the modulation of neurotransmitter systems, particularly the enhancement of cholinergic function, as well as antioxidant effects that mitigate oxidative stress.Purity:Min. 95%





