CAS 67963-68-2

(4-bromophenoxy)-tert-butyldimethylsilane

Description:

(4-bromophenoxy)-tert-butyldimethylsilane, identified by its CAS number 67963-68-2, is an organosilicon compound characterized by the presence of a bromophenyl group and a tert-butyldimethylsilyl moiety. This compound typically exhibits a moderate to high degree of stability under standard conditions, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group for alcohols. The bromine atom in the para position of the phenoxy group can participate in nucleophilic substitution reactions, enhancing its reactivity. The tert-butyldimethylsilyl group provides steric hindrance, which can influence the reactivity and selectivity of the compound in chemical reactions. Additionally, the presence of silicon in its structure contributes to unique properties such as increased hydrophobicity and thermal stability. Overall, this compound is valuable in the field of synthetic organic chemistry, particularly in the development of complex molecules and in the modification of functional groups.

Formula: C₁₂H₁₉BrOSi

InChI: InChI=1/C12H19BrOSi/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6-9H,1-5H3

SMILES: CC(C)(C)[Si](C)(C)Oc1ccc(cc1)Br

(4-Bromophenoxy)(tert-butyl)dimethylsilane

CAS: 67963-68-2

Formula: C₁₂H₁₉BrOSi

Purity: 96%

Color and Shape: Liquid

Molecular weight: 287.2682

Ref: IN-DA003BUV

(4-Bromophenoxy)(tert-butyl)dimethylsilane

CAS: 67963-68-2

(4-Bromophenoxy)(tert-butyl)dimethylsilane

Purity: 97%

Molecular weight: 287.27g/mol

Ref: 54-OR96799

(4-Bromophenoxy)(tert-butyl)dimethylsilane

CAS: 67963-68-2

Formula: C₁₂H₁₉BrOSi

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 287.27

Ref: 3B-B6264

4-Bromophenoxy(t-butyl)dimethylsilane

CAS: 67963-68-2

S25081 - 4-Bromophenoxy(t-butyl)dimethylsilane

Formula: C₁₂H₁₉BrOSi

Purity: 96%

Color and Shape: Liquid, Clear

Molecular weight: 287.272

Ref: 10-S25081

4-Bromophenol tert-Butyldimethylsilyl Ether

Controlled Product

CAS: 67963-68-2

Applications 4-Bromophenol tert-Butyldimethylsilyl Ether (cas# 67963-68-2) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₂H₁₉BrOSi

Color and Shape: Neat

Molecular weight: 287.27

Ref: TR-B686445