CAS 67963-68-2
:(4-bromophenoxy)-tert-butyldimethylsilane
Description:
(4-bromophenoxy)-tert-butyldimethylsilane, identified by its CAS number 67963-68-2, is an organosilicon compound characterized by the presence of a bromophenyl group and a tert-butyldimethylsilyl moiety. This compound typically exhibits a moderate to high degree of stability under standard conditions, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group for alcohols. The bromine atom in the para position of the phenoxy group can participate in nucleophilic substitution reactions, enhancing its reactivity. The tert-butyldimethylsilyl group provides steric hindrance, which can influence the reactivity and selectivity of the compound in chemical reactions. Additionally, the presence of silicon in its structure contributes to unique properties such as increased hydrophobicity and thermal stability. Overall, this compound is valuable in the field of synthetic organic chemistry, particularly in the development of complex molecules and in the modification of functional groups.
Formula:C12H19BrOSi
InChI:InChI=1/C12H19BrOSi/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6-9H,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc(cc1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(4-Bromophenoxy)(tert-butyl)dimethylsilane
CAS:Formula:C12H19BrOSiPurity:95%Color and Shape:LiquidMolecular weight:287.2682(4-Bromophenoxy)(tert-butyl)dimethylsilane
CAS:(4-Bromophenoxy)(tert-butyl)dimethylsilaneFormula:C12H19BrOSiPurity:>97%Molecular weight:287.273(4-Bromophenoxy)(tert-butyl)dimethylsilane
CAS:Formula:C12H19BrOSiPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:287.27(4-Bromophenoxy)(tert-butyl)dimethylsilane
CAS:(4-Bromophenoxy)(tert-butyl)dimethylsilaneFormula:C12H19BrOSiPurity:95%Molecular weight:287.274-Bromophenoxy(t-butyl)dimethylsilane
CAS:S25081 - 4-Bromophenoxy(t-butyl)dimethylsilane
Formula:C12H19BrOSiPurity:96%Color and Shape:Liquid, ClearMolecular weight:287.2724-Bromophenol tert-Butyldimethylsilyl Ether
CAS:Controlled ProductApplications 4-Bromophenol tert-Butyldimethylsilyl Ether (cas# 67963-68-2) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C12H19BrOSiColor and Shape:NeatMolecular weight:287.27





