CymitQuimica logo

CAS 679806-84-9

:

4-pyrimidin-2-ylbenzoyl chloride

Description:
4-Pyrimidin-2-ylbenzoyl chloride is an organic compound characterized by its functional groups, which include a benzoyl chloride moiety and a pyrimidine ring. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The pyrimidine ring contributes to its potential biological activity and may influence its solubility and interaction with other molecules. This compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an acylating agent. Additionally, it may exhibit specific properties such as stability under certain conditions, but it is generally sensitive to moisture and should be handled with care. Safety precautions are essential when working with this compound, as it can be corrosive and may pose health risks if inhaled or in contact with skin.
Formula:C11H7ClN2O
InChI:InChI=1/C11H7ClN2O/c12-10(15)8-2-4-9(5-3-8)11-13-6-1-7-14-11/h1-7H
InChI key:AQFRTZZTRGGBKO-UHFFFAOYSA-N
SMILES:c1cnc(c2ccc(cc2)C(=O)Cl)nc1
Found 1 products.