CymitQuimica logo

CAS 681128-39-2

:

(3,3-difluorocyclobutyl)methanol

Description:
(3,3-Difluorocyclobutyl)methanol is an organic compound characterized by its cyclobutane ring structure, which is substituted with two fluorine atoms at the 3-position and a hydroxymethyl group (-CH2OH) at the 1-position. This compound features a unique combination of fluorine substituents, which can influence its chemical reactivity, polarity, and potential applications in medicinal chemistry or materials science. The presence of fluorine atoms typically enhances the compound's lipophilicity and metabolic stability, making it of interest in drug design. The hydroxymethyl group contributes to its potential as a functionalized building block in organic synthesis. Additionally, the compound's molecular structure suggests it may exhibit interesting conformational properties due to the constraints of the cyclobutane ring. Overall, (3,3-difluorocyclobutyl)methanol is a fluorinated alcohol that may possess unique physical and chemical properties, making it a subject of interest for further research and application in various chemical fields.
Formula:C5H8F2O
InChI:InChI=1/C5H8F2O/c6-5(7)1-4(2-5)3-8/h4,8H,1-3H2
InChI key:MDZKTVVUZBIKGI-UHFFFAOYSA-N
SMILES:C1C(CC1(F)F)CO
Synonyms:
  • Cyclobutanemethanol, 3,3-difluoro-
Found 5 products.