CymitQuimica logo

CAS 681136-29-8

:

1-Piperazinecarboxamide, N-phenyl-4-(3-phenyl-1,2,4-thiadiazol-5-yl)-

Description:
1-Piperazinecarboxamide, N-phenyl-4-(3-phenyl-1,2,4-thiadiazol-5-yl)- is a chemical compound characterized by its complex structure, which includes a piperazine ring and a thiadiazole moiety. This compound typically exhibits properties associated with both piperazine derivatives and thiadiazole compounds, such as potential biological activity and the ability to interact with various biological targets. It may possess characteristics like moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds. The presence of the phenyl groups suggests potential for aromatic interactions, which can influence its reactivity and binding properties. Additionally, compounds of this nature are often investigated for their pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of organic molecules with potential applications in medicinal chemistry and drug development.
Formula:C19H19N5OS
InChI:InChI=1S/C19H19N5OS/c25-18(20-16-9-5-2-6-10-16)23-11-13-24(14-12-23)19-21-17(22-26-19)15-7-3-1-4-8-15/h1-10H,11-14H2,(H,20,25)
InChI key:BHBOSTKQCZEAJM-UHFFFAOYSA-N
SMILES:C1CN(CCN1C2=NC(=NS2)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4
Found 5 products.