CAS 681514-83-0

Benzamide,3-[[4-[[(1R)-2,2-dimethyl-1-(5-methyl-2-furanyl)propyl]amino]-1,1-dioxido-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N,6-trimethyl-

Description:

Benzamide, 3-[[4-[[(1R)-2,2-dimethyl-1-(5-methyl-2-furanyl)propyl]amino]-1,1-dioxido-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N,6-trimethyl- is a complex organic compound characterized by its structural features, which include a benzamide core and multiple functional groups. The presence of a thiadiazole ring contributes to its potential biological activity, while the dimethyl and trimethyl groups enhance its lipophilicity. The compound also contains a hydroxyl group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The furan moiety adds to the compound's aromatic character and may play a role in its interaction with biological targets. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its diverse functional groups that can interact with various biological systems. Its specific properties, such as melting point, solubility, and biological activity, would require empirical investigation for detailed characterization.

Formula: C₂₂H₂₉N₅O₅S

InChI: InChI=1S/C22H29N5O5S/c1-12-8-10-14(17(28)16(12)21(29)27(6)7)23-19-20(26-33(30,31)25-19)24-18(22(3,4)5)15-11-9-13(2)32-15/h8-11,18,28H,1-7H3,(H,23,25)(H,24,26)/t18-/m0/s1

InChI key: MAYXLCLBDVEYAL-SFHVURJKSA-N

SMILES: CC1=C(C(=C(C=C1)NC2=NS(=O)(=O)NC2=N[C@@H](C3=CC=C(O3)C)C(C)(C)C)O)C(=O)N(C)C

3-[[4-[[(1R)-2,2-Dimethyl-1-(5-methyl-2-furanyl)propyl]amino]-1,1-dioxido-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide

CAS: 681514-83-0

3-[[4-[[(1R)-2,2-Dimethyl-1-(5-methyl-2-furanyl)propyl]amino]-1,1-dioxido-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide

Formula: C₂₂H₂₉N₅O₅S

Purity: 99.62%

Molecular weight: 475.56

Ref: 54-OR1115522

3-[[4-[[(1R)-2,2-Dimethyl-1-(5-methyl-2-furanyl)propyl]amino]-1,1-dioxido-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide

CAS: 681514-83-0

Formula: C₂₂H₂₉N₅O₅S

Purity: 99.62%

Color and Shape: Solid

Molecular weight: 475.5612

Ref: IN-DA01TAKQ

Ccr7 ligand 1

CAS: 681514-83-0

Ccr7 Ligand 1 is a synthetic chemotactic cytokine, which is a product designed for research purposes sourced from a specialized laboratory synthesis process. This ligand functions by specifically binding to the CCR7 receptor, thus activating intracellular signaling pathways that are crucial for navigation of cells toward lymphoid organs. It engages in signaling pathways that influence cell migration, maturation, and activation through G-protein coupled receptor mechanisms.

Formula: C₂₂H₂₉N₅O₅S

Purity: Min. 95%

Molecular weight: 475.56 g/mol

Ref: 3D-GCB51483

CCR7 Ligand 1

CAS: 681514-83-0

CCR7-Cmp2105 is a thiadiazole-dioxide allosteric antagonist for CCR7 with a Kd of 3 nM and IC50 of 7.3 μM against arrestin binding.

Formula: C₂₂H₂₉N₅O₅S

Color and Shape: Solid

Molecular weight: 475.561

Ref: TM-T10716