CAS 68162-47-0
:4-(Bromomethyl)phenylboronic acid, cyclic anhydride
Description:
4-(Bromomethyl)phenylboronic acid, cyclic anhydride, is a chemical compound characterized by the presence of a boronic acid functional group and a bromomethyl substituent on a phenyl ring. This compound typically exhibits properties associated with both boronic acids and brominated organic compounds, including reactivity towards nucleophiles and potential applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various coupling reactions, such as Suzuki-Miyaura cross-coupling. The presence of the bromomethyl group can enhance electrophilicity, facilitating further chemical transformations. Additionally, the cyclic anhydride structure may influence the compound's stability and reactivity, particularly in the presence of moisture or other nucleophiles. Overall, this compound is of interest in the development of pharmaceuticals and agrochemicals, as well as in materials science for the synthesis of functionalized polymers. Safety precautions should be observed when handling this compound due to its reactive nature and potential toxicity associated with brominated compounds.
Formula:C7H8BBrO2
InChI:InChI=1/C7H8BBrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5H2
SMILES:c1cc(ccc1CBr)B(O)O
Synonyms:- 4-Bromomethylphenylboronic acid tech.
- 4-(Bromomethyl)benzeneboronic acid
- 4-Boronobenzyl bromide
- 4-(Bromomethyl)phenylboronic acid
- P-(Bromomethyl)Phenylboronic Acid
- 4-Bromomethylphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
[4-(Bromomethyl)phenyl]boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H8BBrO2Color and Shape:White to Light yellow powder to crystalMolecular weight:214.854-(Bromomethyl)benzeneboronic acid, tech. 85%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H8BBrO2Purity:85%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:214.854-(Bromomethyl)phenylboronic acid
CAS:Formula:C7H8BBrO2Purity:98%Color and Shape:SolidMolecular weight:214.85224-(Bromomethyl)benzeneboronic acid
CAS:4-(Bromomethyl)benzeneboronic acidFormula:C7H8BBrO2Purity:≥95%Color and Shape: white crystalline solidMolecular weight:214.85g/mol4-Bromomethylphenylboronic acid (contains varying amounts of anhydride)
CAS:Formula:C7H8BBrO2Purity:95%Color and Shape:SolidMolecular weight:214.854-Bromomethylphenylboronic acid
CAS:Controlled ProductStability Unstable in Aqueous Solution
Applications 4-Bromomethylphenylboronic acidFormula:C7H8BBrO2Color and Shape:NeatMolecular weight:214.85






