CymitQuimica logo

CAS 68162-47-0

:

4-(Bromomethyl)phenylboronic acid, cyclic anhydride

Description:
4-(Bromomethyl)phenylboronic acid, cyclic anhydride, is a chemical compound characterized by the presence of a boronic acid functional group and a bromomethyl substituent on a phenyl ring. This compound typically exhibits properties associated with both boronic acids and brominated organic compounds, including reactivity towards nucleophiles and potential applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various coupling reactions, such as Suzuki-Miyaura cross-coupling. The presence of the bromomethyl group can enhance electrophilicity, facilitating further chemical transformations. Additionally, the cyclic anhydride structure may influence the compound's stability and reactivity, particularly in the presence of moisture or other nucleophiles. Overall, this compound is of interest in the development of pharmaceuticals and agrochemicals, as well as in materials science for the synthesis of functionalized polymers. Safety precautions should be observed when handling this compound due to its reactive nature and potential toxicity associated with brominated compounds.
Formula:C7H8BBrO2
InChI:InChI=1/C7H8BBrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5H2
InChI key:PDNOURKEZJZJNZ-UHFFFAOYSA-N
SMILES:c1cc(ccc1CBr)B(O)O
Synonyms:
  • 4-Bromomethylphenylboronic acid tech.
  • 4-(Bromomethyl)benzeneboronic acid
  • 4-Boronobenzyl bromide
  • 4-(Bromomethyl)phenylboronic acid
  • P-(Bromomethyl)Phenylboronic Acid
  • 4-Bromomethylphenylboronic acid
Found 8 products.