CymitQuimica logo

CAS 68189-42-4

:

Phosphoric acid, mono(4-nitrophenyl) ester, compd. with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:2)

Description:
Phosphoric acid, mono(4-nitrophenyl) ester, compound with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:2), commonly referred to as a phosphoramidate, is a chemical compound characterized by its ester linkage between phosphoric acid and a 4-nitrophenyl group. This compound typically exhibits properties associated with both phosphoric acid derivatives and nitrophenyl esters, including potential applications in biochemistry and pharmaceuticals. The presence of the 2-amino-2-(hydroxymethyl)-1,3-propanediol moiety suggests that it may have biological relevance, possibly serving as a stabilizing agent or a precursor in biochemical pathways. The nitrophenyl group can impart specific reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit solubility in polar solvents and could be sensitive to hydrolysis under certain conditions. Overall, its unique structure and functional groups contribute to its potential utility in research and industrial applications, particularly in the fields of medicinal chemistry and bioconjugation.
Formula:C6H6NO6P·2C4H11NO3
InChI:InChI=1S/C6H6NO6P.C4H11NO3/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;5-4(1-6,2-7)3-8/h1-4H,(H2,10,11,12);6-8H,1-3,5H2
InChI key:InChIKey=YHAXIYFGQRSQOO-UHFFFAOYSA-N
SMILES:O(P(=O)(O)O)C1=CC=C(N(=O)=O)C=C1.C(CO)(CO)(CO)N
Synonyms:
  • 1,3-Propanediol, 2-amino-2-(hydroxymethyl)-, 4-nitrophenyl phosphate (2:1) (salt)
  • 4-Nitrophenyl Dihydrogen Phosphate - 2-Amino-2-(Hydroxymethyl)Propane-1,3-Diol (1:2)
  • 4-Nitrophenyl phosphate di(tris) salt
  • 4-Nitrophenylphosphoric acid di[tris(hydroxymethyl)aminomethane] salt
  • Phosphoric acid, mono(4-nitrophenyl) ester, compd. with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:2)
Found 8 products.