CAS 68194-17-2: 2,2',3,3',4,5,5',6-octachlorobiphenyl
Description:2,2',3,3',4,5,5',6-octachlorobiphenyl, commonly referred to as one of the polychlorinated biphenyls (PCBs), is a synthetic organic compound characterized by its complex structure consisting of two biphenyl rings with eight chlorine atoms substituted at various positions. This compound is part of a larger group of PCBs, which are known for their chemical stability, hydrophobicity, and resistance to degradation, making them persistent environmental pollutants. 2,2',3,3',4,5,5',6-octachlorobiphenyl is typically colorless to light yellow and exhibits low volatility. It is insoluble in water but soluble in organic solvents, which contributes to its bioaccumulation in the food chain. Due to its toxicological properties, including potential carcinogenic effects and endocrine disruption, its use has been heavily restricted or banned in many countries. Environmental monitoring and remediation efforts are ongoing to address the contamination associated with PCBs, including this specific compound, highlighting the importance of understanding its behavior and impact in ecosystems.
Formula:C12H2Cl8
InChI:InChI=1/C12H2Cl8/c13-3-1-4(7(15)5(14)2-3)6-8(16)10(18)12(20)11(19)9(6)17/h1-2H
- Synonyms:
- 1,1'-Biphenyl, 2,2',3,3',4,5,5',6-Octachloro-
- 2,2',3,3',4,5,5',6-Octachloro-1,1'-biphenyl
- 2,2',3,3',4,5',5,6-Octachlorobiphenyl
- 2,2',3,3',4,5,5',6-Pcb
- 68194-17-2
