CymitQuimica logo

CAS 68216-06-8

:

Benzoic acid, 5-chloro-2-methoxy-, ethyl ester

Description:
Benzoic acid, 5-chloro-2-methoxy-, ethyl ester, with the CAS number 68216-06-8, is an organic compound that belongs to the class of benzoate esters. This substance features a benzoic acid core modified by the presence of a chloro group at the 5-position and a methoxy group at the 2-position of the aromatic ring. The ethyl ester functional group indicates that it is derived from benzoic acid through esterification with ethanol. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic esters. It may exhibit properties such as being a potential intermediate in organic synthesis or having applications in the fragrance and flavor industry due to its aromatic nature. Additionally, the presence of chlorine and methoxy groups can influence its reactivity and biological activity, making it of interest in various chemical research fields. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H11ClO3
InChI:InChI=1S/C10H11ClO3/c1-3-14-10(12)8-6-7(11)4-5-9(8)13-2/h4-6H,3H2,1-2H3
InChI key:PYWOQQOGGYVMFM-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C=CC(=C1)Cl)OC
Found 1 products.