CAS 68236-03-3

6-chloropyrido[2,3-b]pyrazine

Description:

6-Chloropyrido[2,3-b]pyrazine is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, with a chlorine substituent at the 6-position of the pyridine ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine atom can influence its reactivity and interaction with biological targets. Additionally, 6-chloropyrido[2,3-b]pyrazine may exhibit properties such as moderate to high melting and boiling points, depending on the specific conditions. Its synthesis often involves multi-step reactions, including halogenation and cyclization processes. As with many heterocycles, it may serve as a scaffold for the development of various pharmaceuticals, particularly in the fields of oncology and infectious diseases. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₇H₄ClN₃

InChI: InChI=1/C7H4ClN3/c8-6-2-1-5-7(11-6)10-4-3-9-5/h1-4H

SMILES: c1cc(Cl)nc2c1nccn2

Synonyms:

• Pyrido[2,3-b]pyrazine, 6-chloro-

6-Chloropyrido[3,2-b]pyrazine

CAS: 68236-03-3

6-Chloropyrido[3,2-b]pyrazine

Formula: C₇H₄ClN₃

Purity: 98%

Molecular weight: 165.57976

Ref: 54-OR960682

6-Chloropyrido[2,3-b]pyrazine

CAS: 68236-03-3

Formula: C₇H₄ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.5798

Ref: IN-DA005LOC

6-Chloropyrido[3,2-b]pyrazine

CAS: 68236-03-3

Formula: C₇H₄ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.58

Ref: 10-F093238

6-Chloropyrido[3,2-b]pyrazine

CAS: 68236-03-3

6-Chloropyrido[3,2-b]pyrazine is a chemical compound that has been shown to be a good candidate for dechlorination and debromination reactions. It can be used as an intermediate in the synthesis of potassium amides and anionically charged compounds. The product is unreactive but reactive towards reductive conditions. 6-Chloropyrido[3,2-b]pyrazine is stable at room temperature and does not react with water.

Formula: C₇H₄ClN₃

Purity: Min. 95%

Molecular weight: 165.58 g/mol

Ref: 3D-TCA23603