CymitQuimica logo

CAS 683242-79-7

:

6-(trifluoromethyl)pyridine-2,3-diamine

Description:
6-(Trifluoromethyl)pyridine-2,3-diamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a trifluoromethyl group (-CF3) at the 6-position of the pyridine ring significantly influences its chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. The compound features amino groups (-NH2) at the 2 and 3 positions, which can participate in hydrogen bonding and nucleophilic substitution reactions. This structure makes it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The trifluoromethyl group also enhances the compound's stability and can affect its biological activity. Additionally, the presence of multiple functional groups allows for diverse reactivity, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit unique toxicological profiles. Overall, 6-(trifluoromethyl)pyridine-2,3-diamine is a versatile compound with significant implications in chemical research and development.
Formula:C6H6F3N3
InChI:InChI=1/C6H6F3N3/c7-6(8,9)4-2-1-3(10)5(11)12-4/h1-2H,10H2,(H2,11,12)
InChI key:MUAUJMRIVQEHHZ-UHFFFAOYSA-N
SMILES:c1cc(C(F)(F)F)nc(c1N)N
Synonyms:
  • 2,3-Pyridinediamine, 6-(Trifluoromethyl)-
  • 6-(Trifluoromethyl)pyridine-2,3-diamine
Found 4 products.