CymitQuimica logo

CAS 68325-15-5

:

3-Chloro-4-cyanopyridine

Description:
3-Chloro-4-cyanopyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 3-position and a cyano group (-C≡N) at the 4-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state. It is known for its moderate solubility in polar organic solvents and limited solubility in water. 3-Chloro-4-cyanopyridine is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its reactivity, particularly in nucleophilic substitution reactions. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested. Proper safety protocols should be followed when working with this compound in laboratory settings.
Formula:C6H3ClN2
InChI:InChI=1/C6H3ClN2/c7-6-4-9-2-1-5(6)3-8/h1-2,4H
InChI key:JLLJPPBGJVCFGG-UHFFFAOYSA-N
SMILES:c1cncc(c1C#N)Cl
Synonyms:
  • 3-Chloropyridine-4-carbonitrile
Found 7 products.