CymitQuimica logo

CAS 68373-65-9

:

2-hydroxy-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxamide

Description:
2-Hydroxy-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxamide, with the CAS number 68373-65-9, is a chemical compound that belongs to the class of dihydropyridines, which are characterized by a six-membered ring containing nitrogen. This compound features a hydroxyl group (-OH) and a carboxamide group (-CONH2), contributing to its polar nature and potential for hydrogen bonding. The presence of the methyl group enhances its lipophilicity, which may influence its biological activity. Dihydropyridines are often studied for their pharmacological properties, particularly in relation to calcium channel modulation and as potential therapeutic agents in cardiovascular diseases. The compound's structure suggests it may exhibit various chemical reactivity, including potential for tautomerization due to the keto-enol equilibrium involving the carbonyl and hydroxyl groups. Additionally, its solubility and stability can be affected by pH and solvent conditions, making it relevant in both synthetic and medicinal chemistry contexts. Overall, this compound's unique structural features position it as a subject of interest in chemical research and drug development.
Formula:C7H8N2O3
InChI:InChI=1/C7H8N2O3/c1-3-2-4(10)5(6(8)11)7(12)9-3/h2H,1H3,(H2,8,11)(H2,9,10,12)
InChI key:SWBBEZHQQWMONY-UHFFFAOYSA-N
SMILES:Cc1cc(c(C(=N)O)c(n1)O)O
Synonyms:
  • 3-Pyridinecarboxamide, 1,2-Dihydro-4-Hydroxy-6-Methyl-2-Oxo-
  • 4-Hydroxy-6-methyl-2-oxo-1,2-dihydropyridine-3-carboxamide
Found 2 products.