CymitQuimica logo

CAS 683775-59-9

:

1H-Pyrrole-2,5-dione,3-[1-(3-aminopropyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)-,monohydrochloride

Description:
1H-Pyrrole-2,5-dione, 3-[1-(3-aminopropyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)-, monohydrochloride, identified by CAS number 683775-59-9, is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring and indole moieties. This compound typically exhibits properties associated with both heterocyclic compounds and amines, such as potential biological activity and solubility in polar solvents. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility in aqueous solutions. The compound may possess pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and reactivity can be influenced by the functional groups present, particularly the amino group and the indole rings, which may participate in various biochemical interactions. As with many organic compounds, safety data and handling precautions should be considered, especially in laboratory settings.
Formula:C23H20N4O2ClH
InChI:InChI=1S/C23H20N4O2.ClH/c24-10-5-11-27-13-17(15-7-2-4-9-19(15)27)21-20(22(28)26-23(21)29)16-12-25-18-8-3-1-6-14(16)18;/h1-4,6-9,12-13,25H,5,10-11,24H2,(H,26,28,29);1H
InChI key:NXIKRXJEVAWDAX-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CN(C5=CC=CC=C54)CCCN.Cl
Found 3 products.