CymitQuimica logo

CAS 6839-91-4

:

Hydrazinecarbothioamide, 2-(di-2-pyridinylmethylene)-

Description:
Hydrazinecarbothioamide, 2-(di-2-pyridinylmethylene)-, with the CAS number 6839-91-4, is an organic compound characterized by its unique structure that includes a hydrazinecarbothioamide moiety and two di-2-pyridinylmethylene groups. This compound typically exhibits properties associated with both hydrazine derivatives and thioamide functionalities, which may include moderate solubility in polar organic solvents and potential reactivity due to the presence of the hydrazine and thioamide groups. It may also display biological activity, making it of interest in medicinal chemistry and research applications. The presence of pyridine rings suggests potential coordination chemistry and interactions with metal ions, which could be relevant in various chemical contexts. Additionally, the compound may undergo various chemical reactions, including oxidation and condensation, due to the reactive nature of its functional groups. Overall, hydrazinecarbothioamide, 2-(di-2-pyridinylmethylene)- is a compound of interest for its structural features and potential applications in synthetic and medicinal chemistry.
Formula:C12H11N5S
InChI:InChI=1S/C12H11N5S/c13-12(18)17-16-11(9-5-1-3-7-14-9)10-6-2-4-8-15-10/h1-8H,(H3,13,17,18)
InChI key:NTFYASWWOZAMQZ-UHFFFAOYSA-N
SMILES:C1=CC=NC(=C1)C(=NNC(=S)N)C2=CC=CC=N2
Found 1 products.