CAS 684-09-3
:2,2,2-Trifluoro-N,N-dimethylethanimidamide
Description:
2,2,2-Trifluoro-N,N-dimethylethanimidamide, with the CAS number 684-09-3, is a chemical compound characterized by its unique trifluoromethyl group and amidine functional group. This substance is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits high thermal stability and is soluble in polar organic solvents, making it useful in various chemical applications. The presence of trifluoromethyl groups imparts distinctive electronic properties, enhancing its reactivity and making it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's structure allows for potential hydrogen bonding interactions, influencing its behavior in biological systems. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2,2,2-Trifluoro-N,N-dimethylethanimidamide is an important compound in the field of chemistry, particularly in the synthesis of more complex molecules.
Formula:C4H7F3N2
InChI:InChI=1S/C4H7F3N2/c1-9(2)3(8)4(5,6)7/h8H,1-2H3
InChI key:InChIKey=MFLSQEVVMJKRGO-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N(C)C)=N
Synonyms:- 2,2,2-Trifluoro-N,N-dimethylethanimidamide
- 2,2,2-Trifluoro-N,N-dimethylacetimidamide
- Ethanimidamide, 2,2,2-trifluoro-N,N-dimethyl-
- Acetamidine, 2,2,2-trifluoro-N,N-dimethyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
