CAS 684282-41-5

5-Norbornene-2-carboxylic acid furfuryl ester

Description:

5-Norbornene-2-carboxylic acid furfuryl ester is an organic compound characterized by its unique structure, which includes a norbornene framework and a furfuryl ester functional group. This compound typically exhibits properties associated with both the norbornene and ester functionalities, such as reactivity in polymerization processes and potential applications in organic synthesis. It is likely to be a colorless to pale yellow liquid, with a distinctive odor. The presence of the carboxylic acid moiety suggests that it can participate in various chemical reactions, including esterification and amidation. Additionally, the norbornene structure allows for cycloaddition reactions, making it valuable in the production of polymers and advanced materials. Its reactivity and structural features make it a candidate for use in specialty chemicals and as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₄O₃

InChI: InChI=1/C13H14O3/c14-12(15)13(8-11-2-1-5-16-11)7-9-3-4-10(13)6-9/h1-5,9-10H,6-8H2,(H,14,15)

InChI key: NKLRWURIOVXVAB-UHFFFAOYSA-N

SMILES: c1cc(CC2(CC3C=CC2C3)C(=O)O)oc1

Synonyms:

• Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid furan-2-ylmethyl ester

Furan-2-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate

CAS: 684282-41-5

Formula: C₁₃H₁₄O₃

Molecular weight: 218.2485

Ref: IN-DA006JUE