CAS 6843-37-4

N-methylpyridine-4-carboxamide

Description:

N-methylpyridine-4-carboxamide, also known by its CAS number 6843-37-4, is an organic compound characterized by a pyridine ring substituted with a methyl group and a carboxamide functional group. This compound typically exhibits a polar nature due to the presence of the carboxamide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents like water. The methyl group enhances its lipophilicity, allowing it to interact with non-polar environments as well. N-methylpyridine-4-carboxamide is often utilized in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structural features contribute to its reactivity, making it a valuable compound in organic chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen atom in the pyridine ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions.

Formula: C₇H₈N₂O

InChI: InChI=1/C7H8N2O/c1-8-7(10)6-2-4-9-5-3-6/h2-5H,1H3,(H,8,10)

SMILES: CNC(=O)c1ccncc1

Synonyms:

• 4-Pyridinecarboxamide, N-methyl-

N-methylisonicotinamide

CAS: 6843-37-4

N-methylisonicotinamide

Formula: C₇H₈N₂O

Purity: ≥97%

Molecular weight: 136.15

Ref: 54-OR1098446

N-Methylisonicotinamide-d3

Controlled Product

CAS: 6843-37-4

Formula: C₇D₃H₅N₂O

Color and Shape: Neat

Molecular weight: 139.17

Ref: TR-M314387

N-Methylisonicotinamide

Controlled Product

CAS: 6843-37-4

Formula: C₇H₈N₂O

Color and Shape: Neat

Molecular weight: 136.15

Ref: TR-M314385