CAS 68499-58-1: 2-deoxy-2-[(fluoroacetyl)amino]-D-galactose

Description:2-deoxy-2-[(fluoroacetyl)amino]-D-galactose is a modified sugar derivative that features a fluorinated acetylamino group attached to the second carbon of the galactose molecule. This compound is characterized by its structural complexity, which includes a hydroxyl group, an amine, and a fluorinated acetyl moiety. The presence of the fluorine atom can impart unique chemical properties, such as increased lipophilicity and altered reactivity compared to its non-fluorinated counterparts. This compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a substrate for specific enzymes. Its applications could span various fields, including medicinal chemistry and biochemistry, particularly in the development of pharmaceuticals or as a biochemical probe. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, as well as its interactions with other biological molecules. Overall, 2-deoxy-2-[(fluoroacetyl)amino]-D-galactose represents an interesting subject for research due to its potential utility in both synthetic and biological contexts.

Formula:C₈H₁₄FNO₆

InChI:InChI=1/C8H14FNO6/c9-1-6(14)10-4(2-11)7(15)8(16)5(13)3-12/h2,4-5,7-8,12-13,15-16H,1,3H2,(H,10,14)/t4-,5+,7+,8-/m0/s1