CymitQuimica logo

CAS 6852-42-2

:

S-(2-carboxypropyl)-L-cysteine

Description:
S-(2-carboxypropyl)-L-cysteine, also known by its CAS number 6852-42-2, is a naturally occurring amino acid derivative of cysteine, characterized by the presence of a carboxypropyl group attached to the sulfur atom of the cysteine backbone. This compound features a thiol (-SH) group, which is typical of cysteine, contributing to its reactivity and ability to form disulfide bonds. The presence of the carboxypropyl group introduces additional functional properties, such as potential chelation of metal ions and involvement in redox reactions. S-(2-carboxypropyl)-L-cysteine is soluble in water, which enhances its bioavailability and interaction with biological systems. It is often studied for its role in cellular processes, including antioxidant activity and protein synthesis. Additionally, this compound may have implications in various biochemical pathways, particularly those related to sulfur metabolism and detoxification. Its unique structure and properties make it a subject of interest in both biochemical research and potential therapeutic applications.
Formula:C7H13NO4S
InChI:InChI=1/C7H13NO4S/c1-4(6(9)10)2-13-3-5(8)7(11)12/h4-5H,2-3,8H2,1H3,(H,9,10)(H,11,12)/t4?,5-/m0/s1
InChI key:QSPWUNSFUXUUDG-AKGZTFGVSA-N
SMILES:CC(CSC[C@@H](C(=O)O)N)C(=O)O
Synonyms:
  • L-Cysteine, S-(2-carboxypropyl)-
Found 6 products.