CymitQuimica logo

CAS 686290-22-2

:

Silacyclopenta-2,4-diene, 2,5-dibromo-1,1-dimethyl-3,4-diphenyl-

Description:
Silacyclopenta-2,4-diene, 2,5-dibromo-1,1-dimethyl-3,4-diphenyl- (CAS 686290-22-2) is a complex organosilicon compound characterized by its unique silacyclopentadiene structure, which incorporates silicon into a cyclic diene framework. This compound features two bromine substituents at the 2 and 5 positions, enhancing its reactivity and potential applications in organic synthesis. The presence of two phenyl groups at the 3 and 4 positions contributes to its stability and influences its electronic properties, making it an interesting candidate for various chemical reactions, including cross-coupling and polymerization. The dimethyl groups at the 1,1 positions provide steric hindrance, which can affect the compound's reactivity and solubility. Overall, this compound's unique structure and substituents make it a valuable subject of study in organosilicon chemistry and materials science, with potential applications in the development of novel materials and electronic devices.
Formula:C18H16Br2Si
InChI:InChI=1S/C18H16Br2Si/c1-21(2)17(19)15(13-9-5-3-6-10-13)16(18(21)20)14-11-7-4-8-12-14/h3-12H,1-2H3
InChI key:XLVXIPAEFXBVBF-UHFFFAOYSA-N
SMILES:C[Si]1(C(=C(C(=C1Br)C2=CC=CC=C2)C3=CC=CC=C3)Br)C
Found 3 products.