CAS 68716-47-2
:(2,4-Dichlorophenyl)boronic acid
Description:
(2,4-Dichlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a dichlorophenyl ring. This compound typically exhibits a white to off-white crystalline solid form and is soluble in polar organic solvents, such as methanol and ethanol, while being less soluble in non-polar solvents. It is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, particularly in organic synthesis and medicinal chemistry. The presence of chlorine substituents on the phenyl ring can influence its reactivity and biological activity, often enhancing its properties for use in drug development and as a reagent in cross-coupling reactions. Additionally, (2,4-Dichlorophenyl)boronic acid can serve as a building block in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential toxicity and environmental concerns.
Formula:C6H5BCl2O2
InChI:InChI=1/C6H5BCl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H
SMILES:c1cc(c(cc1Cl)Cl)B(O)O
Synonyms:- 2,4-Dichlorophenylboronic acid
- 2,4-Dichlorobenzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,4-Dichlorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BCl2O2Purity:97.0 to 111.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:190.812,4-Dichlorobenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5BCl2O2Purity:98%Color and Shape:White to pale cream, Crystals or powder or crystalline powder or lumps or fused solid or granulesMolecular weight:190.812,4-Dichlorophenylboronic acid
CAS:Formula:C6H5BCl2O2Purity:97%Color and Shape:SolidMolecular weight:190.81972,4-Dichlorobenzeneboronic acid
CAS:2,4-Dichlorobenzeneboronic acidFormula:C6H5BCl2O2Purity:98%Color and Shape:SolidMolecular weight:190.81972,4-Dichlorophenylboronic acid
CAS:Formula:C6H5BCl2O2Purity:97%Color and Shape:Solid, Off-white powderMolecular weight:190.812,4-Dichlorophenylboronic Acid extrapure, 98%
CAS:Formula:C6H5BCl2O2Purity:min. 98%Color and Shape:Off - white, PowderMolecular weight:190.82







