CymitQuimica logo

CAS 68779-52-2

:

3,4,6-tri-O-benzyl-1,2-O-(1-methoxyethylidene)hexopyranose

Description:
3,4,6-tri-O-benzyl-1,2-O-(1-methoxyethylidene)hexopyranose is a complex carbohydrate derivative characterized by its multiple benzyl ether substituents and a methoxyethylidene group. This compound features a hexopyranose structure, which is a six-membered ring sugar, typically derived from glucose or similar monosaccharides. The presence of three benzyl groups at the 3, 4, and 6 positions enhances its lipophilicity and stability, making it useful in organic synthesis and as a protecting group in carbohydrate chemistry. The methoxyethylidene moiety at the 1,2 positions provides additional steric hindrance and can influence the reactivity of the sugar, allowing for selective transformations. This compound is often utilized in the synthesis of more complex carbohydrates or glycosides, serving as an intermediate in various chemical reactions. Its unique structure and functional groups make it a valuable compound in both academic research and industrial applications, particularly in the fields of medicinal chemistry and glycoscience.
Formula:C30H34O7
InChI:InChI=1/C30H34O7/c1-30(31-2)36-28-27(34-20-24-16-10-5-11-17-24)26(33-19-23-14-8-4-9-15-23)25(35-29(28)37-30)21-32-18-22-12-6-3-7-13-22/h3-17,25-29H,18-21H2,1-2H3
SMILES:CC1(OC)OC2C(C(C(COCc3ccccc3)OC2O1)OCc1ccccc1)OCc1ccccc1
Found 3 products.