CymitQuimica logo

CAS 68865-32-7

:

4-Acrylamidobenzo-18-crown-6

Description:
4-Acrylamidobenzo-18-crown-6 is a synthetic compound that combines the properties of a crown ether with an acrylamide functional group. This compound features a crown ether structure, which is known for its ability to selectively bind cations, particularly alkali and alkaline earth metals, due to its cyclic polyether framework. The presence of the acrylamide group introduces reactivity, allowing for potential polymerization and cross-linking, which can be advantageous in various applications such as drug delivery, sensor technology, and materials science. The crown ether moiety enhances the solubility and stability of the compound in polar solvents, while the acrylamide functionality can facilitate interactions with other chemical species. Additionally, 4-Acrylamidobenzo-18-crown-6 may exhibit unique optical and electronic properties, making it a subject of interest in research related to supramolecular chemistry and functional materials. Its specific applications and behavior can vary based on the surrounding environment and the presence of other chemical entities.
Formula:C19H27NO7
InChI:InChI=1/C19H27NO7/c1-2-19(21)20-16-3-4-17-18(15-16)27-14-12-25-10-8-23-6-5-22-7-9-24-11-13-26-17/h2-4,15H,1,5-14H2,(H,20,21)
InChI key:UGHKKCVGQTWASH-UHFFFAOYSA-N
SMILES:C=CC(=O)NC1=CC2=C(C=C1)OCCOCCOCCOCCOCCO2
Synonyms:
  • N-(2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)prop-2-enamide
Found 4 products.