CymitQuimica logo

CAS 688798-62-1

:

2-Bromo-N-ethyl-N-methylbenzenesulfonamide

Description:
2-Bromo-N-ethyl-N-methylbenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the bromine atom in the aromatic ring contributes to its reactivity and potential applications in organic synthesis. The N-ethyl and N-methyl substituents indicate that the compound has two alkyl groups attached to the nitrogen atom, which can influence its solubility and biological activity. This compound is likely to be a solid at room temperature and may exhibit moderate to high polarity due to the sulfonamide group. Its structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H12BrNO2S
InChI:InChI=1S/C9H12BrNO2S/c1-3-11(2)14(12,13)9-7-5-4-6-8(9)10/h4-7H,3H2,1-2H3
InChI key:InChIKey=WHEJQAOSOOTARQ-UHFFFAOYSA-N
SMILES:S(N(CC)C)(=O)(=O)C1=C(Br)C=CC=C1
Synonyms:
  • Benzenesulfonamide, 2-bromo-N-ethyl-N-methyl-
  • 2-Bromo-N-ethyl-N-methylbenzenesulfonamide
  • 2-Bromo-N-ethyl-N-methylbenzene-1-sulfonamide
Found 1 products.