CymitQuimica logo

CAS 689-09-8

:

methyl 3-amino-3-thioxopropanoate

Description:
Methyl 3-amino-3-thioxopropanoate, with the CAS number 689-09-8, is an organic compound characterized by the presence of both an amino group and a thioxo group within its structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents, which is common for compounds containing amino and ester functional groups. The thioxo group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Methyl 3-amino-3-thioxopropanoate may be used in the synthesis of pharmaceuticals, agrochemicals, or other organic compounds due to its functional groups. Additionally, it may exhibit biological activity, although specific biological properties would require further investigation. As with many organic compounds, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.
Formula:C4H7NO2S
InChI:InChI=1/C4H7NO2S/c1-7-4(6)2-3(5)8/h2H2,1H3,(H2,5,8)
InChI key:DVXKSWIBOSXJRV-UHFFFAOYSA-N
SMILES:COC(=O)CC(=N)S
Found 5 products.