CymitQuimica logo

CAS 68960-97-4

:

3,6,9,12-Tetraoxatetradecane-1,14-diamine

Description:
3,6,9,12-Tetraoxatetradecane-1,14-diamine, with the CAS number 68960-97-4, is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages. This molecule features a linear structure with four ether (–O–) groups interspersed between carbon atoms, contributing to its hydrophilic properties. The presence of amine groups (–NH2) at both ends of the molecule enhances its potential for forming hydrogen bonds, which can influence its solubility in water and other polar solvents. This compound is typically used in various applications, including as a surfactant, in polymer chemistry, and in the synthesis of more complex molecules. Its unique structure allows for flexibility and potential interactions with other chemical species, making it of interest in materials science and medicinal chemistry. Additionally, the tetraoxatetradecane backbone may impart certain thermal and mechanical properties, which can be advantageous in specific industrial applications. Overall, this compound exemplifies the versatility of polyether and polyamine chemistry.
Formula:C10H24N2O4
InChI:InChI=1S/C10H24N2O4/c11-1-3-13-5-7-15-9-10-16-8-6-14-4-2-12/h1-12H2
InChI key:IFZOPNLVYZYSMQ-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCN)N
Synonyms:
  • 1,14-Diamino-3,6,9,12-Tetraoxatetradecane
  • H2N-Peg5-Nh2
Found 7 products.