CymitQuimica logo

CAS 68981-84-0

:

3-(4,4-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)-4-methylpyridine

Description:
3-(4,4-Dimethyl-4,5-dihydro-1,3-oxazol-2-yl)-4-methylpyridine, with the CAS number 68981-84-0, is an organic compound characterized by its complex structure, which includes a pyridine ring and an oxazole moiety. The presence of the dimethyl and dihydro groups contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit polar characteristics due to the nitrogen and oxygen atoms in its structure, which can engage in hydrogen bonding. Its molecular framework suggests potential applications in pharmaceuticals or agrochemicals, where such heterocyclic compounds are often utilized for their biological activity. Additionally, the specific arrangement of substituents can affect its electronic properties, making it of interest in materials science and organic synthesis. As with many organic compounds, safety data should be consulted for handling and usage, as the toxicity and environmental impact can vary based on structural features. Overall, this compound represents a fascinating example of the diversity found in organic chemistry.
Formula:C11H14N2O
InChI:InChI=1/C11H14N2O/c1-8-4-5-12-6-9(8)10-13-11(2,3)7-14-10/h4-6H,7H2,1-3H3
InChI key:MWTCTUQKTUNCRO-UHFFFAOYSA-N
SMILES:Cc1ccncc1C1=NC(C)(C)CO1
Found 2 products.