CymitQuimica logo

CAS 69-75-0

:

Uridine-t

Description:
Uridine, with the CAS number 69-75-0, is a nucleoside composed of a pyrimidine base (uridine) linked to a ribose sugar. It is a key component of RNA, playing a crucial role in various biological processes, including protein synthesis and cellular metabolism. Uridine is characterized by its ability to participate in the formation of nucleotides, which are the building blocks of nucleic acids. It is soluble in water and exhibits a relatively stable structure under physiological conditions. Uridine can be phosphorylated to form uridine monophosphate (UMP), which is essential for the synthesis of RNA and serves as a precursor for other nucleotides. Additionally, uridine has been studied for its potential therapeutic effects, including neuroprotective properties and its role in enhancing cognitive function. Its presence in various foods and its availability as a dietary supplement highlight its importance in nutrition and health. Overall, uridine is a vital molecule in biochemistry, contributing to the fundamental processes of life.
Formula:C9H11N2O6T
InChI:InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1
InChI key:DRTQHJPVMGBUCF-XVFCMESISA-N
SMILES:C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O
Synonyms:
  • Uridine-t
Found 1 products.