CymitQuimica logo

CAS 69065-91-4

:

ethyl [(4-fluorophenyl)amino](oxo)acetate

Description:
Ethyl [(4-fluorophenyl)amino](oxo)acetate, with the CAS number 69065-91-4, is an organic compound characterized by its ester functional group and the presence of a fluorinated aromatic amine. This compound features an ethyl ester moiety, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The 4-fluorophenyl group indicates the presence of a fluorine atom on the para position of the phenyl ring, which can influence the compound's electronic properties and reactivity. The amino group attached to the aromatic ring suggests potential for hydrogen bonding and interaction with other chemical species. Additionally, the oxoacetate part of the molecule indicates the presence of a carbonyl group, which can participate in nucleophilic addition reactions. Overall, ethyl [(4-fluorophenyl)amino](oxo)acetate is likely to exhibit interesting chemical behavior due to its structural features, making it a candidate for various applications in pharmaceuticals or organic synthesis.
Formula:C10H10FNO3
InChI:InChI=1/C10H10FNO3/c1-2-15-10(14)9(13)12-8-5-3-7(11)4-6-8/h3-6H,2H2,1H3,(H,12,13)
InChI key:OUBZLXSQKQMFAH-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=Nc1ccc(cc1)F)O
Synonyms:
  • Acetic acid, 2-[(4-fluorophenyl)amino]-2-oxo-, ethyl ester
Found 4 products.