CymitQuimica logo

CAS 690671-26-2

:

2-(2-ethylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid

Description:
2-(2-Ethylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid, identified by its CAS number 690671-26-2, is a chemical compound that belongs to the class of isoindole derivatives. This compound features a fused ring system that includes an isoindole structure, which is characterized by a bicyclic arrangement of a benzene ring and a five-membered nitrogen-containing ring. The presence of the carboxylic acid functional group contributes to its acidity and potential reactivity. The dioxo groups indicate the presence of two carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The ethylphenyl substituent enhances the compound's hydrophobic character, potentially influencing its solubility and interaction with biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C17H13NO4
InChI:InChI=1/C17H13NO4/c1-2-10-5-3-4-6-14(10)18-15(19)12-8-7-11(17(21)22)9-13(12)16(18)20/h3-9H,2H2,1H3,(H,21,22)
SMILES:CCc1ccccc1N1C(=O)c2ccc(cc2C1=O)C(=O)O
Synonyms:
  • 1H-isoindole-5-carboxylic acid, 2-(2-ethylphenyl)-2,3-dihydro-1,3-dioxo-
  • 2-(2-Ethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid
Found 1 products.