CAS 69076-62-6
:2,4,6-tribromo-3-nitrophenol
Description:
2,4,6-Tribromo-3-nitrophenol is an organic compound characterized by the presence of three bromine atoms and one nitro group attached to a phenolic ring. Its molecular structure features a phenol group, where the hydroxyl (-OH) functional group is bonded to a benzene ring that is further substituted at the 2, 4, and 6 positions with bromine atoms and at the 3 position with a nitro group (-NO2). This compound is typically a solid at room temperature and exhibits a yellow to brown coloration. It is known for its potential applications in various fields, including as a reagent in organic synthesis and as a biocide. The presence of multiple halogen atoms contributes to its reactivity and stability, while the nitro group enhances its electrophilic character. Additionally, 2,4,6-tribromo-3-nitrophenol may exhibit antimicrobial properties, making it of interest in environmental and pharmaceutical research. However, safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H2Br3NO3
InChI:InChI=1/C6H2Br3NO3/c7-2-1-3(8)6(11)4(9)5(2)10(12)13/h1,11H
InChI key:IFNFSKQWRJSFRI-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C(=C1Br)O)Br)[N+](=O)[O-])Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
