CAS 69155-76-6
:6-fluoro-2-oxo-chromene-3-carbaldehyde
Description:
6-Fluoro-2-oxo-chromene-3-carbaldehyde is a chemical compound belonging to the chromene family, characterized by its fused benzene and pyran rings. This compound features a fluorine atom at the 6-position, which can influence its reactivity and biological activity. The presence of the aldehyde functional group at the 3-position contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The keto group at the 2-position enhances the compound's electrophilic character, making it suitable for various chemical reactions, including nucleophilic additions. Additionally, the chromene structure often exhibits interesting photophysical properties, which can be exploited in materials science and dye applications. The compound's solubility and stability can vary depending on the solvent and environmental conditions, making it essential to consider these factors in practical applications. Overall, 6-fluoro-2-oxo-chromene-3-carbaldehyde is a valuable compound in synthetic organic chemistry with potential applications in medicinal chemistry and materials science.
Formula:C10H5FO3
InChI:InChI=1/C10H5FO3/c11-8-1-2-9-6(4-8)3-7(5-12)10(13)14-9/h1-5H
SMILES:c1cc2c(cc(C=O)c(=O)o2)cc1F
Synonyms:- 2H-1-benzopyran-3-carboxaldehyde, 6-fluoro-2-oxo-
- 6-Fluoro-2-oxo-2H-chromene-3-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-Fluorochromone-3-carboxaldehyde
CAS:Formula:C10H5FO3Purity:>98.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:192.156-Fluorochromone-3-carboxaldehyde, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H5FO3Purity:97%Color and Shape:Crystals or powder or crystalline powder, Pale yellowMolecular weight:192.156-Fluoro-4-oxo-4H-chromene-3-carbaldehyde
CAS:6-Fluoro-4-oxo-4H-chromene-3-carbaldehydeFormula:C10H5FO3Purity:98%Molecular weight:192.146-Fluoro-4-oxo-4H-chromene-3-carbaldehyde
CAS:Formula:C10H5FO3Purity:98%Color and Shape:SolidMolecular weight:192.14336-Fluoro-3-formylchromone
CAS:6-Fluoro-3-formylchromoneFormula:C10H5FO3Purity:97%Molecular weight:192.14336-Fluorochromone-3-carboxaldehyde
CAS:Formula:C10H5FO3Purity:≥ 98.0%Color and Shape:Off-white to yellow powderMolecular weight:192.156-Fluoro-4-oxo-4H-chromene-3-carbaldehyde
CAS:Formula:C10H5FO3Purity:98%Color and Shape:SolidMolecular weight:192.145






