CymitQuimica logo

CAS 69182-49-6

:

(3aS,6S)-6,7-dimethoxy-2,2-dimethyl-4-(trityloxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran

Description:
The chemical substance with the name "(3aS,6S)-6,7-dimethoxy-2,2-dimethyl-4-(trityloxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran" and CAS number "69182-49-6" is a complex organic compound characterized by its unique structural features, including a tetrahydro-dioxolo framework and multiple methoxy and trityl substituents. This compound exhibits chirality, indicated by its specific stereochemical descriptors, which can influence its reactivity and interactions in biological systems. The presence of methoxy groups suggests potential for solubility in organic solvents and may enhance its pharmacological properties. The trityloxymethyl group can provide stability and protection for reactive sites during synthetic processes. Overall, this compound may be of interest in medicinal chemistry and organic synthesis, particularly for applications requiring specific stereochemical configurations or enhanced solubility. Its detailed properties, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for comprehensive characterization.
Formula:C30H34O6
InChI:InChI=1/C30H34O6/c1-29(2)35-25-24(34-28(32-4)27(31-3)26(25)36-29)20-33-30(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19,24-28H,20H2,1-4H3/t24?,25-,26?,27?,28-/m0/s1
SMILES:CC1(C)O[C@H]2C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)O[C@@H](C(C2O1)OC)OC
Found 2 products.