CymitQuimica logo

CAS 69195-96-6

:

1-benzyl-5-nitro-1H-imidazole-4-carboxylic acid

Description:
1-Benzyl-5-nitro-1H-imidazole-4-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a benzyl group enhances its lipophilicity, potentially influencing its biological activity. The nitro group at the 5-position serves as an electron-withdrawing group, which can affect the compound's reactivity and stability. The carboxylic acid functional group at the 4-position contributes to its acidity and can participate in hydrogen bonding, making it soluble in polar solvents. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, the specific biological activities and mechanisms of action would require further investigation through experimental studies. Overall, 1-benzyl-5-nitro-1H-imidazole-4-carboxylic acid represents a versatile scaffold for further chemical modifications and research in the field of organic and medicinal chemistry.
Formula:C11H9N3O4
InChI:InChI=1/C11H9N3O4/c15-11(16)9-10(14(17)18)13(7-12-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,15,16)
InChI key:AOEZXACMKKLMIY-UHFFFAOYSA-N
SMILES:c1ccc(cc1)Cn1cnc(c1N(=O)=O)C(=O)O
Synonyms:
  • 1H-imidazole-4-carboxylic acid, 5-nitro-1-(phenylmethyl)-
  • 5-Nitro-1-(phenylmethyl)-1H-imidazole-4-carboxylic acid 5-nitro-1-(phenylmethyl)-1h-imidazolle-4-carboxylic acid
  • 1-Benzyl-5-nitro-1H-imidazole-4-carboxylic acid
Found 3 products.