CymitQuimica logo

CAS 6926-54-1

:

4-(2-Methoxyethyl)-thiosemicarbazide

Description:
4-(2-Methoxyethyl)-thiosemicarbazide is an organic compound characterized by its thiosemicarbazide functional group, which features a sulfur atom bonded to a carbonyl and an amine. This compound typically appears as a solid and is known for its potential biological activity, including antimicrobial and anticancer properties. The presence of the methoxyethyl group enhances its solubility in organic solvents, making it useful in various chemical applications. Its molecular structure allows for hydrogen bonding, which can influence its reactivity and interaction with other molecules. Additionally, thiosemicarbazides are often studied for their ability to form coordination complexes with metal ions, which can be relevant in medicinal chemistry and materials science. Safety data indicates that, like many thiosemicarbazides, it should be handled with care due to potential toxicity and reactivity. Overall, 4-(2-Methoxyethyl)-thiosemicarbazide is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its properties and applications.
Formula:C4H11N3OS
InChI:InChI=1/C4H11N3OS/c1-8-3-2-6-4(9)7-5/h2-3,5H2,1H3,(H2,6,7,9)
SMILES:COCCN=C(NN)S
Synonyms:
  • N-(2-methoxyethyl)hydrazinecarbothioamide
Found 1 products.