CymitQuimica logo

CAS 692739-25-6

:

1H-Pyrrole-1-hexanoic acid, 2,5-dihydro-2,5-dioxo-, pentafluorophenylester

Description:
1H-Pyrrole-1-hexanoic acid, 2,5-dihydro-2,5-dioxo-, pentafluorophenyl ester, identified by CAS number 692739-25-6, is a chemical compound characterized by its unique structure that includes a pyrrole ring and a hexanoic acid moiety. This compound features a pentafluorophenyl ester group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the dioxo functional groups indicates that it may exhibit significant reactivity, particularly in condensation reactions or as a potential electrophile. The fluorinated aromatic ring enhances the compound's lipophilicity and may influence its biological activity, making it of interest in drug design. Additionally, the pyrrole structure is known for its role in various biological systems and can participate in diverse chemical reactions. Overall, this compound's unique combination of functional groups and structural features suggests potential utility in synthetic chemistry and medicinal applications.
Formula:C16H12F5NO4
InChI:InChI=1S/C16H12F5NO4/c17-11-12(18)14(20)16(15(21)13(11)19)26-10(25)4-2-1-3-7-22-8(23)5-6-9(22)24/h5-6H,1-4,7H2
InChI key:CIQYBTAUACRWKP-UHFFFAOYSA-N
SMILES:C1=CC(=O)N(C1=O)CCCCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F
Found 4 products.