CymitQuimica logo

CAS 6929-04-0

:

15-methylpalmitic acid methyl ester

Description:
15-Methylpalmitic acid methyl ester, also known by its CAS number 6929-04-0, is a methyl ester derived from 15-methylpalmitic acid, which is a branched-chain fatty acid. This compound typically exhibits characteristics common to fatty acid methyl esters, such as being a colorless to pale yellow liquid at room temperature. It is generally insoluble in water but soluble in organic solvents like ethanol and chloroform. The presence of the methyl ester functional group contributes to its reactivity, making it suitable for various chemical reactions, including transesterification and esterification processes. This compound may be used in the synthesis of surfactants, lubricants, and other industrial applications. Additionally, its branched structure can influence its physical properties, such as melting and boiling points, compared to its straight-chain counterparts. As with many fatty acid derivatives, it may also exhibit biological activity, although specific biological properties would depend on the context of its use. Safety data should be consulted for handling and exposure guidelines.
Formula:C18H36O2
InChI:InChI=1/C18H36O2/c1-17(2)15-13-11-9-7-5-4-6-8-10-12-14-16-18(19)20-3/h17H,4-16H2,1-3H3
SMILES:CC(C)CCCCCCCCCCCCCC(=O)OC
Synonyms:
  • Methyl 15-Methylhexadecanoate
Found 1 products.